| Identification | |
| Name: | potassium isopentyl dithiocarbonate |
| Synonyms: | carbonicacid,dithio-,o-isopentylester,potassiumsalt ; Carbonodithioicacid,O-(3-methylbutyl)ester,potassiumsalt ; potassiumisopentylxanthate ; potassiumisopentylxanthogenate ; potassiumo-isoamylxanthate ; POTASSIUM ISOAMYLXANTHATE ; |
| CAS: | 928-70-1 |
| EINECS: | 213-180-2 |
| Molecular Formula: | C6H12OS2.K |
| Molecular Weight: | 202.38 |
| InChI: | InChI=1/C6H12OS2.K/c1-5(2)3-4-7-6(8)9;/h5H,3-4H2,1-2H3,(H,8,9);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 65.3°C |
| Boiling Point: | 184.4°Cat760mmHg |
| Density: | g/cm3 |
| Refractive index: | 1.521 |
| Specification: |
Potassium isoamyl xanthate , its cas register number is 928-70-1. It also can be called Carbonic acid, dithio-, O-isopentyl ester, potassium salt ; EINECS 213-180-2 ; NSC 4864 ; O-(3-Methylbutyl)carbonodithioate, potassium salt ; Potassium O-isoamyl xanthate ; Potassium isopentyl xanthate ; Potassium isopentyl xanthogenate .Potassium isoamyl xanthate (CAS NO.928-70-1) is moderately toxic by ingestion. When heated to decomposition it emits toxic fumes of NOx and K2O. |
| Flash Point: | 65.3°C |
| Safety Data | |
 |
|
