| Identification | |
| Name: | Glycine,N-(carboxymethyl)-, sodium salt (1:2) |
| Synonyms: | Aceticacid, iminodi-, disodium salt (8CI); Glycine, N-(carboxymethyl)-, disodium salt(9CI); DSIDA; Disodium iminodiacetate; IDA disodium salt; Iminodiacetic aciddisodium salt; Iminodiacetic acid sodium salt |
| CAS: | 928-72-3 |
| EINECS: | 205-555-4 |
| Molecular Formula: | C4H7 N O4 . 2 Na |
| Molecular Weight: | 133.10268 |
| InChI: | InChI=1S/C4H7NO4/c6-3(7)1-5-2-4(8)9/h5H,1-2H2,(H,6,7)(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.436g/cm3 |
| Water Solubility: | Moderately soluble in water |
| Solubility: | Moderately soluble in water |
| Appearance: | yellow crystalline powder |
| Specification: | Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| Report: |
Reported in EPA TSCA Inventory. |
| Color: | ORTHORHOMBIC CRYSTALS |
| Safety Data | |
 |
|
