Identification |
Name: | 1-(6-Chloro-9H-carbazol-2-yl)ethanone (Carprofen Impurity) |
CAS: | 92841-22-0 |
Molecular Formula: | C14H10ClNO |
Molecular Weight: | 0 |
InChI: | InChI=1/C14H10ClNO/c1-8(17)9-2-4-11-12-7-10(15)3-5-13(12)16-14(11)6-9/h2-7,16H,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 227.8°C |
Boiling Point: | 453.1°C at 760 mmHg |
Density: | 1.357g/cm3 |
Refractive index: | 1.725 |
Flash Point: | 227.8°C |
Usage: | A potential degradation product of Carprofen. A known impurity of Carprofen. |
Safety Data |
|
 |