| Identification | |
| Name: | 5-Chloro-3,4-diaminopyridine |
| Synonyms: | 3,4-Pyridinediamine, 5-chloro-; |
| CAS: | 929074-42-0 |
| Molecular Formula: | C5H6ClN3 |
| Molecular Weight: | 143.57 |
| InChI: | InChI=1/C5H6ClN3/c6-3-1-9-2-4(7)5(3)8/h1-2H,7H2,(H2,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.447 |
| Refractive index: | 1.685 |
| Specification: |
The 5-Chloro-3,4-diaminopyridine, with the CAS registry number 929074-42-0, is also known as 3,4-Pyridinediamine, 5-chloro-. This chemical's molecular formula is C5H6ClN3 and molecular weight is 143.57. Its systematic name is called 5-chloropyridine-3,4-diamine. Physical properties of 5-Chloro-3,4-diaminopyridine: (1)ACD/LogP: 1.42; (2)ACD/LogD (pH 5.5): 0.07; (3)ACD/LogD (pH 7.4): 1.31; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 5.48; (6)ACD/KOC (pH 5.5): 6.36; (7)ACD/KOC (pH 7.4): 109.51; (8)#H bond acceptors: 3; (9)#H bond donors: 4; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.685; (12)Molar Refractivity: 37.71 cm3; (13)Molar Volume: 99.1 cm3; (14)Surface Tension: 72 dyne/cm; (15)Density: 1.447 g/cm3; (16)Flash Point: 171 °C; (17)Enthalpy of Vaporization: 60.47 kJ/mol; (18)Boiling Point: 359.1 °C at 760 mmHg; (19)Vapour Pressure: 2.43E-05 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
