| Identification | |
| Name: | 1H-Pyrrole-2,5-dione,1-(4-benzoylphenyl)- |
| Synonyms: | N-(4-Benzoylphenyl)maleimide |
| CAS: | 92944-71-3 |
| Molecular Formula: | C17H11 N O3 |
| Molecular Weight: | 277.27 |
| InChI: | InChI=1/C17H11NO3/c19-15-10-11-16(20)18(15)14-8-6-13(7-9-14)17(21)12-4-2-1-3-5-12/h1-11H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 223.7°C |
| Boiling Point: | 472.9°Cat760mmHg |
| Density: | 1.33g/cm3 |
| Refractive index: | 1.651 |
| Specification: | Light Beige Solid usageEng:A sulfhydryl reactive heterobifunctional photocrosslinking reagent. It generates photoactivatable conjugates from thiols Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 223.7°C |
| Storage Temperature: | 2-8°C |
| Usage: | A sulfhydryl reactive heterobifunctional photocrosslinking reagent. It generates photoactivatable conjugates from thiols |
| Safety Data | |
 |
|
