| Identification |
| Name: | 2'-Acetonaphthone |
| Synonyms: | 2-Acetylnaphthalene~Methyl 2-naphthyl ketone; Methyl 2-naphthyl ketone; 2-Acetonaphthone; 2-Acetylnaphthalene; Acetylnaphtalene; 1-(2-Naphthyl)ethan-1-one; Methyl 2-naphth ketone |
| CAS: | 93-08-3 |
| EINECS: | 202-216-2 |
| Molecular Formula: | C12H10O |
| Molecular Weight: | 170.21 |
| InChI: | InChI=1/C12H10O/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11/h2-8H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.628(lit.) |
| Water Solubility: | insoluble |
| Solubility: | Insoluble |
| Appearance: | white to light yellow powder |
| Packinggroup: | III |
| HS Code: | 29143900 |
| Storage Temperature: | Keep containers tightly closed. Store in a cool, dry area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
