| Identification | |
| Name: | 2-Quinolinecarboxylicacid |
| Synonyms: | Quinaldicacid (8CI);2-Carboxyquinoline;2-Quinolinic acid;2-Quinolinylcarboxylic acid;NSC 4882;Quinolin-2-carboxylic acid; |
| CAS: | 93-10-7 |
| EINECS: | 202-218-3 |
| Molecular Formula: | C10H7NO2 |
| Molecular Weight: | 173.17 |
| InChI: | InChI=1/C10H7NO2/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9/h1-6H,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 247-250 |
| Density: | 1.339 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5897 (160 C) |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Slightly brown powder. |
| HS Code: | 29334990 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | For the determination of copper, zinc and uranium with which it forms insoluble salts. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
