Identification |
Name: | Quinoline,2-(2-methylpropyl)- |
Synonyms: | Quinoline,2-isobutyl- (8CI); 2-Isobutylquinoline |
CAS: | 93-19-6 |
EINECS: | 202-227-2 |
Molecular Formula: | C13H15 N |
Molecular Weight: | 185.29 |
InChI: | InChI=1/C13H15N/c1-10(2)9-12-8-7-11-5-3-4-6-13(11)14-12/h3-8,10H,9H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 111.1°C |
Boiling Point: | 277.3°C at 760 mmHg |
Density: | 1.012g/cm3 |
Refractive index: | 1.58 |
Specification: |
2-Isobutylquinoline ,its cas register number is 93-19-6. It also can be called 2-(2-Methylpropyl)quinoline ; Quinoline, isobutyl- ; Quinoline, (2-methylpropyl)- and Isobutylquinoline .
|
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 111.1°C |
Safety Data |
Hazard Symbols |
T: Toxic
|
|
 |