| Identification | |
| Name: | 7-Hydroxycoumarin |
| Synonyms: | Umbelliferone,99%; Umbelliferone |
| CAS: | 93-35-6 |
| EINECS: | 202-240-3 |
| Molecular Formula: | C9H6O3 |
| Molecular Weight: | 162.14 |
| InChI: | InChI=1/C9H6O3/c10-7-3-1-6-2-4-9(11)12-8(6)5-7/h1-5,10H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 181 |
| Boiling Point: | 382 |
| Density: | 1.403g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.64 |
| Solubility: | soluble in hot water (freely soluble in acetic acid) |
| Appearance: | off-white crystalline powder |
| HS Code: | 29322980 |
| Flash Point: | 181 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | A metabolite of Coumarin. The aglucon of skimmin. Present in many plants |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
