| Identification | |
| Name: | Phenol,4-(2-naphthalenylamino)- |
| Synonyms: | Phenol,p-(2-naphthylamino)- (7CI,8CI); 4-(2-Naphthylamino)phenol; 4-Hydroxyphenyl-b-naphthylamine;N-(4-Hydroxyphenyl)-2-naphthylamine; N-(p-Hydroxyphenyl)-2-naphthylamine;N-(p-Hydroxyphenyl)-b-naphthylamine; NSC 15372; NSC 21065; Paraoxyneozone;p-(2-Naphthylamino)phenol; p-(b-Naphthylamino)phenol; p-Hydroxyneozon; p-Hydroxyneozone;p-Hydroxyphenyl-2-naphthylamine; p-Hydroxyphenyl-b-naphthylamine |
| CAS: | 93-45-8 |
| EINECS: | 202-248-7 |
| Molecular Formula: | C16H13 N O |
| Molecular Weight: | 235.30 |
| InChI: | InChI=1/C16H13NO/c18-16-9-7-14(8-10-16)17-15-6-5-12-3-1-2-4-13(12)11-15/h1-11,17-18H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 139-142 °C(lit.) |
| Flash Point: | 173.1°C |
| Boiling Point: | 424.4°C at 760 mmHg |
| Density: | 1.251g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.733 |
| Specification: |
Phenols and cresols are much weaker as acids than common carboxylic acids ,which are incompatible with strong reducing substances such as hydrides, nitrides, alkali metals, and sulfides. Flammable gas (H2) is often generated, and the heat of the reaction may ignite the gas. Heat is also generated by the acid-base reaction between phenols and bases. Such heating may initiate polymerization of the organic compound. Phenols are also nitrated very rapidly, even by dilute nitric acid.Phenols are sulfonated very readily (for example, by concentrated sulfuric acid at room temperature). |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 173.1°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
