| Identification | |
| Name: | Butanamide,N-(2-chlorophenyl)-3-oxo- |
| Synonyms: | Acetoacetanilide,2'-chloro- (6CI,8CI);AAoC;Acetoacet-o-chloroanilide;Acetoacetic acid 2-chloroanilide;o-Acetoacetochloroanilide;o-Chloroacetoacetanilide;NSC 3913;N-Acetoacetyl-2-chloroaniline;N-(2-Chlorophenyl)-3-oxobutanamide;N-(2-Chlorophenyl)acetoacetamide;Acetoacetic acido-chloroanilide;Acetoacetyl-2-chloroanilide;Acetoacetyl-o-chloroanilide; |
| CAS: | 93-70-9 |
| EINECS: | 202-269-1 |
| Molecular Formula: | C10H10ClNO2 |
| Molecular Weight: | 211.6449 |
| InChI: | InChI=1S/C10H10ClNO2/c1-7(13)6-10(14)12-9-5-3-2-4-8(9)11/h2-5H,6H2,1H3,(H,12,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Melting Point: | 105 - 107 C |
| Flash Point: | 176 C |
| Boiling Point: | 1.192 |
| Density: | 1.1920 |
| Refractive index: | 1.584 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | white crystalline powder |
| Specification: | White to off-white powder usageEng:Acetoacet-o-chloranilide is used as intermediate for the manufacture of organic pigments. Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 176 C |
| Usage: | Acetoacet-o-chloranilide is used as intermediate for the manufacture of organic pigments. |
| Safety Data | |
| Hazard Symbols | |
 |
|
