With the CAS registry number 930298-25-2, the systematic name of this chemical is (5-amino-4-chloro-2-methyl-phenyl) ethyl carbonate. It is an organic compound which the molecular formula is C10H12ClNO3 and the molecular weight is 229.66. Additionally, this chemical should be avoided direct sunshine.
The other characteristics of 5-Amino-4-chloro-2-methylphenyl ethyl carbonate can be summarized as: (1)ACD/LogP: 1.99; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.987; (4)ACD/LogD (pH 7.4): 1.987; (5)ACD/BCF (pH 5.5): 19.052; (6)ACD/BCF (pH 7.4): 19.059; (7)ACD/KOC (pH 5.5): 286.919; (8)ACD/KOC (pH 7.4): 287.024; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 61.55 Å2; (13)Index of Refraction: 1.555; (14)Molar Refractivity: 57.928 cm3; (15)Molar Volume: 180.437 cm3; (16)Polarizability: 22.964×10-24 cm3; (17)Surface Tension: 45.098 dyne/cm; (18)Density: 1.273 g/cm3; (19)Flash Point: 165.564 °C; (20)Enthalpy of Vaporization: 59.472 kJ/mol; (21)Boiling Point: 350.149 °C at 760 mmHg; (22)Vapour Pressure: 0 mmHg at 25°C.
People can use the following data to convert to the molecule structure.
1. SMILES:CCOC(=O)Oc1cc(c(cc1C)Cl)N
2. InChI:InChI=1/C10H12ClNO3/c1-3-14-10(13)15-9-5-8(12)7(11)4-6(9)2/h4-5H,3,12H2,1-2H3
3. InChIKey:OUVLLFXUJXYMCI-UHFFFAOYAQ
4. Std. InChI:InChI=1S/C10H12ClNO3/c1-3-14-10(13)15-9-5-8(12)7(11)4-6(9)2/h4-5H,3,12H2,1-2H3
5. Std. InChIKey:OUVLLFXUJXYMCI-UHFFFAOYSA-N
|