| Identification | |
| Name: | 2-Fluoro-5-methylbenzaldehyde |
| Synonyms: | Benzaldehyde, 2-fluoro-5-methyl-;6-Fluoro-m-tolualdehyde; |
| CAS: | 93249-44-6 |
| Molecular Formula: | C8H7FO |
| Molecular Weight: | 138.14 |
| InChI: | InChI=1/C8H7FO/c1-6-2-3-8(9)7(4-6)5-10/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Flash Point: | 178? |
| Density: | 1.129 |
| Refractive index: | 1.5160 |
| Appearance: | Light yellow or a colourless liquid |
| Specification: | Safety Statements:26-27-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 178? |
| Storage Temperature: | Room temperature. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
