| Identification | |
| Name: | Cyclohexanol,1-[(1R)-2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]- |
| Synonyms: | Cyclohexanol,1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]-, (R)-; (+)-Venlafaxine; (R)-(+)-Venlafaxine |
| CAS: | 93413-46-8 |
| Molecular Formula: | C17H27 N O2 |
| Molecular Weight: | 277.4 |
| InChI: | InChI=1/C17H27NO2/c1-18(2)13-16(17(19)11-5-4-6-12-17)14-7-9-15(20-3)10-8-14/h7-10,16,19H,4-6,11-13H2,1-3H3/t16-/m0/s1 |
| Molecular Structure: | ![(C17H27NO2) Cyclohexanol,1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]-, (R)-; (+)-Venlafaxine; (R)-(+)-Venlafa...](https://img1.guidechem.com/chem/e/dict/74/93413-46-8.jpg) |
| Properties | |
| Melting Point: | 100-102?C |
| Flash Point: | 194.246°C |
| Boiling Point: | 397.575°C at 760 mmHg |
| Density: | 1.06g/cm3 |
| Refractive index: | 1.544 |
| Specification: | White to Off-White Solid usageEng:A optically active version of Venlafaxine, a selective serotonin noradrenaline reuptake inhibitor. Used as an antidepressant. |
| Flash Point: | 194.246°C |
| Storage Temperature: | Refrigerator |
| Usage: | A optically active version of Venlafaxine, a selective serotonin noradrenaline reuptake inhibitor. Used as an antidepressant. |
| Safety Data | |
 |
|
