| Identification | |
| Name: | 2-Imidazolidinone,4,5-bis(4-penten-1-yloxy)- |
| Synonyms: | 2-Imidazolidinone,4,5-bis(4-pentenyloxy)- (7CI) |
| CAS: | 93431-23-3 |
| Molecular Formula: | C13H22 N2 O3 |
| Molecular Weight: | 254.37 |
| InChI: | InChI=1/C13H22N2O3/c1-3-5-7-9-17-11-12(15-13(16)14-11)18-10-8-6-4-2/h3-4,11-12H,1-2,5-10H2,(H2,14,15,16) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 215.9°C |
| Boiling Point: | 433.4°Cat760mmHg |
| Density: | 1.05g/cm3 |
| Refractive index: | 1.497 |
| Specification: |
4,5-Bis(4-pentenyloxy)-2-imidazolidinone ,its CAS number is 93431-23-3,it can be called 2-Imidazolidinone, 4,5-bis(4-pentenyloxy)- . It is a moderate toxic substance,with flammability, burning will produce toxic nitrogen oxides fumes,so it should be stored in cool and dry environment,separate from oxidant and acid.Dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Flash Point: | 215.9°C |
| Safety Data | |
 |
|
