| Identification | |
| Name: | Phenol,2,3,5,6-tetrachloro- |
| Synonyms: | 2,3,5,6-Tetrachlorophenol;NSC 407823 |
| CAS: | 935-95-5 |
| EINECS: | 213-310-8 |
| Molecular Formula: | C6H2 Cl4 O |
| Molecular Weight: | 231.88 |
| InChI: | InChI=1/C6H2Cl4O/c7-2-1-3(8)5(10)6(11)4(2)9/h1,11H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2020 6.1/PG 3 |
| Flash Point: | 111.7°C |
| Boiling Point: | 261°Cat760mmHg |
| Density: | 1.709g/cm3 |
| Refractive index: | 1.62 |
| Solubility: | Very soluble in benzene, slightly soluble in water, soluble in ligroin. |
| Specification: |
2,3,5,6-Tetrachlorophenol ,its cas register number is 935-95-5. It also can be called Phenol, 2,3,5,6-tetrachloro- ; and 2,3,5,6-Tetrachlorophenate . It is incompatible with acid chlorides, acid anhydrides and oxidizing agents. |
| Report: |
Chlorophenol compounds are on the Community Right-To-Know List. |
| Flash Point: | 111.7°C |
| Storage Temperature: | APPROX 4°C |
| Color: | Leaf, from ligroin |
| Safety Data | |
 |
|
