| Identification |
| Name: | Benzaldehyde,5-bromo-2-fluoro- |
| Synonyms: | 2-Fluoro-5-bromobenzaldehyde;3-Bromo-6-fluorobenzaldehyde;2-Fluoro-5-Bromo benzaldehyde;5-Bromo-2-fluoro-benzaldehyde; |
| CAS: | 93777-26-5 |
| EINECS: | 298-056-6 |
| Molecular Formula: | C7H4BrFO |
| Molecular Weight: | 203.01 |
| InChI: | InChI=1/C7H4BrFO/c8-6-2-1-5(4-10)7(9)3-6/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.67g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.568-1.57 |
| Water Solubility: | INSOLUBLE |
| Solubility: | INSOLUBLE |
| Appearance: | clear yellowish liquid |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Do not expose to air. Store under an inert atmosphere. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
