| Identification | |
| Name: | Pyrido[2,3-d]pyrimidine,2,4,7-trichloro- |
| Synonyms: | 2,4,7-Trichloropyrido[2,3-d]pyrimidine |
| CAS: | 938443-20-0 |
| Molecular Formula: | C7H2 Cl3 N3 |
| Molecular Weight: | 234.47 |
| InChI: | InChI=1/C7H2Cl3N3/c8-4-2-1-3-5(9)12-7(10)13-6(3)11-4/h1-2H |
| Molecular Structure: | ![(C7H2Cl3N3) 2,4,7-Trichloropyrido[2,3-d]pyrimidine](https://img1.guidechem.com/chem/e/dict/167/938443-20-0.jpg) |
| Properties | |
| Density: | 1.685g/cm3 |
| Refractive index: | 1.688 |
| Specification: |
The 2,4,7-Trichloropyrido[2,3-d]pyrimidine with cas registry number of 938443-20-0, is also called Pyrido[2,3-d]pyrimidine, 2,4,7-trichloro- . Physical properties of 2,4,7-Trichloropyrido[2,3-d]pyrimidine :(1)ACD/LogP: 2.14; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.14; (4)ACD/LogD (pH 7.4): 2.14; (5)#H bond acceptors: 3; (6)#H bond donors: 0; (7)#Freely Rotating Bonds: 0; (8)Polar Surface Area: 38.67 Å2; (9)Index of Refraction: 1.688; (10)Molar Refractivity: 53.05 cm3; (11)Molar Volume: 139 cm3; (12)Polarizability: 21.03×10-24cm3; (13)Surface Tension: 69.2 dyne/cm. You can still convert the following datas into molecular structure: (1)SMILES:Clc2nc(Cl)nc1nc(Cl)ccc12; (2)InChI:InChI=1/C7H2Cl3N3/c8-4-2-1-3-5(9)12-7(10)13-6(3)11-4/h1-2H; (3)InChIKey:DNFDLCRLLQVUQK-UHFFFAOYAE; (4)Std. InChI:InChI=1S/C7H2Cl3N3/c8-4-2-1-3-5(9)12-7(10)13-6(3)11-4/h1-2H; (5)Std. InChIKey:DNFDLCRLLQVUQK-UHFFFAOYSA-N. |
| Safety Data | |
 |
|
