Identification |
Name: | FLUVASTATIN SODIUM |
Synonyms: | fluvastatin sodium salt; sodium (3r,5s,6e)-7-[3-(4-fluorophenyl)-1-(1-methylethyl)-1h-indol-2-yl]-3,5-dihydroxy-6-heptenoate |
CAS: | 93957-55-2 |
Molecular Formula: | C24H25FNNaO4 |
Molecular Weight: | 433.45 |
InChI: | InChI=1/C24H26FNO4.Na/c1-15(2)26-21-6-4-3-5-20(21)24(16-7-9-17(25)10-8-16)22(26)12-11-18(27)13-19(28)14-23(29)30;/h3-12,15,18-19,27-28H,13-14H2,1-2H3,(H,29,30);/q;+1/p-1/b12-11+;/t18-,19-;/m0./s1 |
Molecular Structure: |
|
Properties |
Melting Point: | 194-197oC |
Appearance: | Light yellow solid powder |
Specification: | Yellow Powder usageEng:A synthetic HMG-CoA reductase inhibitor. Antilipemic |
Biological Activity: | Orally active, potent and competitive HMG-CoA reductase inhibitor (IC 50 = 40 -100 nM at human liver microsomes). Inhibits vascular smooth muscle proliferation in vitro (IC 50 = 70 nM) and exhibits antihypercholesterolemic and antioxidant activity in vivo . |
Usage: | A synthetic HMG-CoA reductase inhibitor. Antilipemic |
Safety Data |
|
|