Identification |
Name: | 1,3-Benzenediol,1,3-dibenzoate |
Synonyms: | 1,3-Benzenediol,dibenzoate (9CI); Resorcinol, dibenzoate (6CI,7CI,8CI);1,3-Bis(benzoyloxy)benzene; 1,3-Dibenzoyloxybenzene; 1,3-Phenylene dibenzoate;NSC 33405; NSC 4906 |
CAS: | 94-01-9 |
EINECS: | 202-294-8 |
Molecular Formula: | C20H14 O4 |
Molecular Weight: | 318.32 |
InChI: | InChI=1/C20H14O4/c21-19(15-8-3-1-4-9-15)23-17-12-7-13-18(14-17)24-20(22)16-10-5-2-6-11-16/h1-14H |
Molecular Structure: |
 |
Properties |
Melting Point: | 115-117 °C
|
Flash Point: | 93°C |
Boiling Point: | 450 °C
|
Density: | 1.242g/cm3 |
Refractive index: | 1.615 |
Appearance: | white to beige or pale brown crystalline powder |
Specification: | WHITE TO BEIGE OR PALE BROWN CRYSTALLINE POWDER Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 93°C |
Safety Data |
|
 |