| Identification | |
| Name: | Peroxide,bis(4-chlorobenzoyl) |
| Synonyms: | Peroxide,bis(p-chlorobenzoyl) (6CI,8CI); 4,4'-Dichlorobenzoyl peroxide; 4-Chlorobenzoylperoxide; Bis(4-chlorobenzoyl) peroxide; Bis(p-chlorobenzoyl) peroxide; CadoxPS; Di(p-chlorobenzoyl) peroxide; p,p'-Dichlorobenzoyl peroxide;p,p'-Dichlorodibenzoyl peroxide; p-Chlorobenzoyl peroxide |
| CAS: | 94-17-7 |
| EINECS: | 202-310-3 |
| Molecular Formula: | C14H8 Cl2 O4 |
| Molecular Weight: | 311.12 |
| InChI: | InChI=1/C14H8Cl2O4/c15-11-7-3-1-5-9(11)13(17)19-20-14(18)10-6-2-4-8-12(10)16/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 52047 |
| Melting Point: | 137-138 deg C |
| Boiling Point: | 427.1°C at 760 mmHg |
| Density: | 1.17 |
| Refractive index: | 1.602 |
| Solubility: | Insol in water; sol in organic solvents |
| Specification: |
Bis(P-Chlorobenzoyl) Peroxide (CAS NO.94-17-7) is a odorless white solid or paste. It can sinks in water. In pure crystalline form there is danger of explosion upon heating, shock, or friction. Peroxides are good oxidizing agents. Organic compounds can ignite on contact with concentrated peroxides. Strongly reduced material such as sulfides, nitrides, and hydrides may react explosively with peroxides. There are few chemical classes that do not at least produce heat when mixed with peroxides. Many produce explosions or generate gases (toxic and nontoxic). Generally, dilute solutions of peroxides (<70%) are safe, but the presence of a catalyst (often a transition metal such as cobalt, iron, manganese, nickel, or vanadium) as an impurity may even then cause rapid decomposition, a buildup of heat, and even an explosion.Irritates eyes and (on prolonged contact) skin. Ingestion causes irritation of mouth and stomach. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| Color: | White, granular Powder |
| Safety Data | |
 |
|
