Identification |
Name: | Hexanoic acid,2-ethyl-, 1,1'-[1,2-ethanediylbis(oxy-2,1-ethanediyl)] ester |
Synonyms: | Hexanoic acid,2-ethyl-, 1,2-ethanediylbis(oxy-2,1-ethanediyl) ester (9CI);Hexanoic acid,2-ethyl-, diester with triethylene glycol (6CI,7CI,8CI);Triethylene glycol,bis(2-ethylhexanoate) (8CI);3GO;Flexol 3GO;S 2075;TegMeR 803;Triethyleneglycol bis(ethylhexanoate);Triethylene glycol di(2-ethylhexanoate);Triethylene glycol di-2-ethylhexoate; |
CAS: | 94-28-0 |
EINECS: | 202-319-2 |
Molecular Formula: | C22H42O6 |
Molecular Weight: | 402.57 |
InChI: | InChI=1/C22H42O6/c1-5-9-11-19(7-3)21(23)27-17-15-25-13-14-26-16-18-28-22(24)20(8-4)12-10-6-2/h19-20H,5-18H2,1-4H3 |
Molecular Structure: |
 |
Properties |
Density: | 0.967 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.4432-1.4452 |
Water Solubility: | Insoluble |
Solubility: | Insoluble |
Appearance: | Colorless liquid. |
Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Usage: | Plasticizer. |
Safety Data |
|
 |