| Identification | |
| Name: | Methoxone ((4-Chloro-2-methylphenoxy) acetic acid) (MCPA) |
| Synonyms: | Aceticacid, (4-chloro-2-methylphenoxy)- (9CI); Acetic acid, (4-chloro-o-toloxy)-(4CI); Acetic acid, [(4-chloro-o-tolyl)oxy]- (8CI);(2-Methyl-4-chlorophenoxy)acetic acid; (4-Chloro-2-methylphenoxy)acetic acid;2-(4-Chloro-2-methylphenoxy)acetic acid; 2M-4Ch; 2M2Kh; 2M4Kh; Agritox; Agritox50; Agroxon; Agroxone; Anicon M; Anicon kombi; B-Selektonon M; CMPA; Chwastox30; Chwastox Extra; Dicopur M; Emcepan; Hedapur M 52; Hedarex M; Hedonal M;Herbicide M; Hormoneste; Leuna M; MCP; MCP (herbicide); MCPA; MCPA (acid);Mecaphar; Mephanac; Metaxon; Methoxone; NSC 2351; Netazol; Okultin M; Rhonox; U46 M-fluid; [(4-Chloro-o-tolyl)oxy]acetic acid |
| CAS: | 94-74-6 |
| EINECS: | 202-360-6 |
| Molecular Formula: | C9H9 Cl O3 |
| Molecular Weight: | 200.619 |
| InChI: | InChI=1S/C9H9ClO3/c1-6-4-7(10)2-3-8(6)13-5-9(11)12/h2-4H,5H2,1H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2765 |
| Density: | 1.313 g/cm3 |
| Solubility: | INSOL IN CARBON DISULFIDE; SOLUBILITY (G/100 ML): ETHER 77, ETHANOL 153, N-HEPTANE 0.5, TOLUENE 6.2, XYLENE 4.9 SOL IN CARBON TETRACHLORIDE Free acid insol in water but sodium and amine salts are soluble Sol in benzene Diethyl ether 770 mg/l In water, 630 mg/l @ 25 deg C |
| Appearance: | white powder |
| Color: | White to light brown solid flakes, crystal powder or liquid. Plates from benzene or toluene White crystalline solid (pure compd) Colorless crystalline solid (pure) |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
