Identification |
Name: | Acetic acid,2-[(4-chloro-2-methylphenyl)thio]- |
Synonyms: | Aceticacid, [(4-chloro-2-methylphenyl)thio]- (9CI); Acetic acid,[(4-chloro-o-tolyl)thio]- (6CI,7CI,8CI); (4-Chloro-o-tolylmercapto)acetic acid;Red 3B Acid; [(4-Chloro-o-tolyl)thio]acetic acid |
CAS: | 94-76-8 |
EINECS: | 202-362-7 |
Molecular Formula: | C9H9 Cl O2 S |
Molecular Weight: | 216.69 |
InChI: | InChI=1/C9H9ClO2S/c1-6-4-7(10)2-3-8(6)13-5-9(11)12/h2-4H,5H2,1H3,(H,11,12) |
Molecular Structure: |
![(C9H9ClO2S) Aceticacid, [(4-chloro-2-methylphenyl)thio]- (9CI); Acetic acid,[(4-chloro-o-tolyl)thio]- (6CI,7CI,8...](https://img1.guidechem.com/chem/e/dict/39/94-76-8.jpg) |
Properties |
Flash Point: | 165.1°C |
Boiling Point: | 349.4°Cat760mmHg |
Density: | 1.36g/cm3 |
Refractive index: | 1.61 |
Specification: |
Chlorotolylthioglycolic acid , its cas register number is 94-76-8. It also can be called ((4-Chloro-o-tolyl)thio)acetic acid ; (4-Chloro-2-methylbenzenemercapto)acetic acid ; (4-Chloro-o-tolylmercapto)acetic acid ; 4-Chloro-2-methylphenylthioglycolic acid ; Acetic acid, ((4-chloro-2-methylphenyl)thio)- ; Acetic acid, ((4-chloro-o-tolyl)thio)- ; Acetic acid, 2-((4-chloro-2-methylphenyl)thio)- ; and 4-Chloro-o-tolylthioacetic acid .
|
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 165.1°C |
Safety Data |
|
 |