| Identification | |
| Name: | 2,4-DB |
| Synonyms: | Butyricacid, 4-(2,4-dichlorophenoxy)- (8CI); 2,4-DB; 2,4-DM;2,4-Dichlorophenoxybutyric acid; 4-(2,4-Dichlorophenoxy)butanoic acid;4-(2,4-Dichlorophenoxy)butyric acid; Buratal; Butyrac; Butyrac 118; Legumex;Legumex D; NSC 70337; Sys 67 Buratal; g-(2,4-Dichlorophenoxy)butyric acid |
| CAS: | 94-82-6 |
| EINECS: | 202-366-9 |
| Molecular Formula: | C10H10 Cl2 O3 |
| Molecular Weight: | 249.10 |
| InChI: | InChI=1/C10H10Cl2O3/c1-2-8(10(13)14)15-9-4-3-6(11)5-7(9)12/h3-5,8H,2H2,1H3,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Melting Point: | 118-120 ºC |
| Boiling Point: | 150 (0.2 torr) |
| Density: | 1.369g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.552 |
| Solubility: | 46 ppm at 25 C |
| Appearance: | Colorless crystals. |
| Specification: |
4-(2,4-Dichlorophenoxy)butyric acid (94-82-6) is colorless crystals, known as 2,4-D butyric acid ; 2,4-DB ; 2,4-DM ; 4-(2,4-Dichlorophenoxy)butanoic acid ; 4-(2,4-Dichlorophenoxy)butyric acid ; 4-06-00-00927 (Beilstein Handbook Reference) ; Buratal ; Butirex ; Butormone ; Butoxon ; Butoxone ; Butoxone amine ; Butoxone ester ; Butyrac ; Butyrac 118 ; Butyrac 200 ; Butyrac ester ; CCRIS 1021 ; Caswell No. 316 ; EPA Pesticide Chemical Code 030801 ; HSDB 6603 ; Kyselina 4-(2,4-dichlorfenoxy)maselna ; Kyselina 4-(2,4-dichlorfenoxy)maselna [Czech] ; Legumex D ; NSC 70337 ; Sys 67 Buratal ; gamma-(2,4-Dichlorophenoxy)butyric acid ; 2,4-(Dichlorophenoxy)butyric acid ; Butanoic acid, 4-(2,4-dichlorophenoxy)- ; Butanoic acid, 4-(2,4-dichlorophenoxy)- (9CI) ; Butyric acid, 4-(2,4-dichlorophenoxy)- . 4-(2,4-Dichlorophenoxy)butyric acid (94-82-6) is a selective systemic phenoxy herbicide used to control many annual and perennial broadleaf weeds in alfalfa, peanuts, soybeans, and other crops. It is classified in toxicity class III. |
| Report: |
EPA Genetic Toxicology Program. |
| Packinggroup: | III |
| Storage Temperature: | 0-6°C |
| Color: | White crystals White to light brown crystals |
| Usage: | Control of broad-leafed plants in row crops, defoliants, general brush control. Chlorophenoxy compounds, from table. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
