| Identification | |
| Name: | Ethanol,2-[(2-chlorophenyl)amino]- |
| Synonyms: | Ethanol,2-(o-chloroanilino)- (6CI,7CI,8CI); 2-(2-Chlorophenylamino)ethanol;2-(o-Chloroanilino)ethanol; 2-Chloro-N-(2-hydroxyethyl)aniline; 2-Chloro-N-(b-hydroxyethyl)aniline; NSC 510554 |
| CAS: | 94-87-1 |
| EINECS: | 202-371-6 |
| Molecular Formula: | C8H10 Cl N O |
| Molecular Weight: | 171.63 |
| InChI: | InChI=1/C8H10ClNO/c9-7-3-1-2-4-8(7)10-5-6-11/h1-4,10-11H,5-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 146.2°C |
| Boiling Point: | 318.1°Cat760mmHg |
| Density: | 1.272g/cm3 |
| Refractive index: | 1.612 |
| Specification: |
2-Chloro-N-(2-hydroxyethyl)aniline with CAS registry number of 94-87-1 is known as 2-(o-Chloroanilino)ethanol ; NSC 510554 ; Ethanol, 2-((2-chlorophenyl)amino)- ; Ethanol, 2-(o-chloroanilino)- (8CI) . |
| Flash Point: | 146.2°C |
| Safety Data | |
 |
|
