Identification |
Name: | Propanoicacid, 2-(4-hydroxyphenoxy)-, (2R)- |
Synonyms: | R(+)-2-(4-Hydroxyphenoxy)propionic acid;Propanoicacid, 2-(4-hydroxyphenoxy)-, (R)-;(+)-2-(4-Hydroxyphenoxy)propionic acid;(R)-2-(4-Hydroxyphenoxy)propanoicacid;D-2-(4-Hydroxyphenoxy)propionic acid;HPPA; |
CAS: | 94050-90-5 |
EINECS: | 407-960-3 |
Molecular Formula: | C9H10O4 |
Molecular Weight: | 182.18 |
InChI: | InChI=1/C9H10O4/c1-6(9(11)12)13-8-4-2-7(10)3-5-8/h2-6,10H,1H3,(H,11,12)/t6-/m1/s1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 151.3oC |
Boiling Point: | 367.5oCat760mmHg |
Density: | 1.302g/cm3 |
Alpha: | 58 o (C=1, MEOH) |
Appearance: | White crystal |
Specification: | Safety Statements:26-39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 39:Wear eye/face protection |
Flash Point: | 151.3oC |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |