| Identification | |
| Name: | Propanoicacid, 2-(4-hydroxyphenoxy)-, (2R)- |
| Synonyms: | R(+)-2-(4-Hydroxyphenoxy)propionic acid;Propanoicacid, 2-(4-hydroxyphenoxy)-, (R)-;(+)-2-(4-Hydroxyphenoxy)propionic acid;(R)-2-(4-Hydroxyphenoxy)propanoicacid;D-2-(4-Hydroxyphenoxy)propionic acid;HPPA; |
| CAS: | 94050-90-5 |
| EINECS: | 407-960-3 |
| Molecular Formula: | C9H10O4 |
| Molecular Weight: | 182.18 |
| InChI: | InChI=1/C9H10O4/c1-6(9(11)12)13-8-4-2-7(10)3-5-8/h2-6,10H,1H3,(H,11,12)/t6-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 151.3oC |
| Boiling Point: | 367.5oCat760mmHg |
| Density: | 1.302g/cm3 |
| Alpha: | 58 o (C=1, MEOH) |
| Appearance: | White crystal |
| Specification: | Safety Statements:26-39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 39:Wear eye/face protection |
| Flash Point: | 151.3oC |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
