| Identification | |
| Name: | Benzoic acid,3-amino-4-chloro-, 2-(dimethylamino)ethyl ester, hydrochloride (1:1) |
| Synonyms: | Benzoicacid, 3-amino-4-chloro-, 2-(dimethylamino)ethyl ester, monohydrochloride (9CI);Benzoic acid, 3-amino-4-chloro-, 2-dimethylaminoethyl ester, hydrochloride(6CI); Clormecaine hydrochloride |
| CAS: | 94110-08-4 |
| EINECS: | 302-547-3 |
| Molecular Formula: | C11H15 Cl N2 O2 . Cl H |
| Molecular Weight: | 279.19 |
| InChI: | InChI=1/C11H15ClN2O2.ClH/c1-14(2)5-6-16-11(15)8-3-4-9(12)10(13)7-8;/h3-4,7H,5-6,13H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 170.5°C |
| Boiling Point: | 358.2°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
3-Amino-4-chlorobenzoic acid 2-((dimethylamino)ethyl) ester hydrochloride (CAS NO.94110-08-4) is also called 3-Amino-4-cloro-benzoato di dimetilaminoetile cloridrato ; 4-Cloro-3-aminobenzoato di dimetilaminoetile cloridrato ; REC 1-0060 ; (2-Dimethylamino)ethyl 3-amino-4-chlorobenzoate monohydrochloride ; Benzoic acid, 3-amino-4-chloro-, 2-((dimethylamino)ethyl) ester, monohydrochloride . 3-Amino-4-chlorobenzoic acid 2-((dimethylamino)ethyl) ester hydrochloride (CAS NO.94110-08-4) is moderate toxic. It is flammable. It will produce toxic nitrogen oxide and hydrogen chloride fumes when buring. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 170.5°C |
| Safety Data | |
 |
|
