Identification |
Name: | sebacic acid, compound with 1,3,5-triazine-2,4,6-triamine (1:2) |
Synonyms: | Sebacic acid, compound with 1,3,5-triazine-2,4,6-triamine (1:2);decanedioic acid; 1,3,5-triazine-2,4,6-triamine |
CAS: | 94159-19-0 |
EINECS: | 303-195-3 |
Molecular Formula: | C16H30N12O4 |
Molecular Weight: | 454.4874 |
InChI: | InChI=1/C10H18O4.2C3H6N6/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;2*4-1-7-2(5)9-3(6)8-1/h1-8H2,(H,11,12)(H,13,14);2*(H6,4,5,6,7,8,9) |
Molecular Structure: |
![(C16H30N12O4) Sebacic acid, compound with 1,3,5-triazine-2,4,6-triamine (1:2);decanedioic acid; 1,3,5-triazine-2,4...](https://img.guidechem.com/pic/image/94159-19-0.gif) |
Properties |
Flash Point: | 537°C |
Boiling Point: | 964.3°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 537°C |
Safety Data |
|
![](/images/detail_15.png) |