Identification |
Name: | 2-phenoxyethyl tridecyl benzene-1,2-dicarboxylate |
Synonyms: | AC1MJ63Y;Phenoxyethyl tridecyl phthalate ester;1,2-Benzenedicarboxylic acid, mixed 2-phenoxyethyl and tridecyl esters;Phthalic acid mixed 2-phenoxyethyl and tridecyl esters;2-O-(2-phenoxyethyl) 1-O-tridecyl benzene-1,2-dicarboxylate;94214-54-7 |
CAS: | 94214-54-7 |
Molecular Formula: | C29H40O5 |
Molecular Weight: | 468.6249 |
InChI: | InChI=1/C29H40O5/c1-2-3-4-5-6-7-8-9-10-11-17-22-33-28(30)26-20-15-16-21-27(26)29(31)34-24-23-32-25-18-13-12-14-19-25/h12-16,18-21H,2-11,17,22-24H2,1H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 233.7°C |
Boiling Point: | 557.8°C at 760 mmHg |
Density: | 1.045g/cm3 |
Refractive index: | 1.52 |
Flash Point: | 233.7°C |
Safety Data |
|
|