| Identification | |
| Name: | 1H-Pyrazolo[4,3-b]pyridine,5-chloro- |
| Synonyms: | 5-Chloro-1H-pyrazolo[4,3-b]pyridine; |
| CAS: | 94220-45-8 |
| Molecular Formula: | C6H4ClN3 |
| Molecular Weight: | 153.57 |
| InChI: | InChI=1/C6H4ClN3/c7-6-2-1-4-5(9-6)3-8-10-4/h1-3H,(H,8,10) |
| Molecular Structure: | ![(C6H4ClN3) 5-Chloro-1H-pyrazolo[4,3-b]pyridine;](https://img1.guidechem.com/chem/e/dict/18/94220-45-8.jpg) |
| Properties | |
| Density: | 1.531 g/cm3 |
| Refractive index: | 1.72 |
| Specification: |
The 5-Chloro-1H-pyrazolo[4,3-b]pyridine with the CAS number 94220-45-8 is also called 1H-Pyrazolo[4,3-b]pyridine,5-chloro-. Its molecular formula is C6H4ClN3. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 1.08; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.08; (4)ACD/LogD (pH 7.4): 1.08; (5)ACD/BCF (pH 5.5): 3.9; (6)ACD/BCF (pH 7.4): 3.89; (7)ACD/KOC (pH 5.5): 92.25; (8)ACD/KOC (pH 7.4): 91.86; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 41.57 Å2; (13)Index of Refraction: 1.72; (14)Molar Refractivity: 39.6 cm3; (15)Molar Volume: 100.2 cm3; (16)Polarizability: 15.7×10-24cm3; (17)Surface Tension: 74.7 dyne/cm; (18)Enthalpy of Vaporization: 54.32 kJ/mol; (19)Vapour Pressure: 0.000485 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
