| Identification | |
| Name: | Santowax P |
| Synonyms: | 1,4-DIPHENYLBENZENE |
| CAS: | 94363-13-0 |
| Molecular Formula: | C18H14 |
| Molecular Weight: | 230.3 |
| InChI: | InChI=1S/C18H14/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16/h1-14H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 210.1 DEG C |
| Flash Point: | 188.1°C |
| Boiling Point: | 400°Cat760mmHg |
| Density: | 1.046g/cm3 |
| Solubility: | SOL IN BENZENE & ETHANOL (ORDER OF SOLUBILITY IN THESE SUBSTANCES DECR FROM ORTHO TO PARA FORM) Sparingly soluble in lower alcohols and glycols; soluble in common aromatic solvents. Water solubility = 1.79X10-2 mg/l at 25 deg C |
| Flash Point: | 188.1°C |
| Color: | COLORLESS OR LIGHT-YELLOW SOLID White or light-yellow solid. |
| Safety Data | |
 |
|
