| Identification | |
| Name: | CROMAKALIM |
| Synonyms: | AKOS 91890;(+/-)-CROMAKALIM;CROMAKALIM;TRANS-3,4-DIHYDRO-3-HYDROXY-2,2-DIMETHYL-4-(2-OXO-1-PYRROLIDINYL)-2H-1-BENZOPYRAN-6-CARBONITRILE;(+/-)-TRANS-6-CYANO-3,4-DIHYDRO-2,2-DIMETHYL-4-(2-OXOPYRROLIDIN-1-YL)-2H-1-BENZOPYRAN-3-OL;[+/-]-TRANS-6-CYANO-3,4-DIHYDRO-2,2-DIMETHYL-4-[2-OXOPYRROLIDIN-1-YL]-2H-1-BENZOPYRAN-3-OL;Cromakalim=([+/-]-trans-6-Cyano-3,4-dihydro-2,2-;BRL-34915 |
| CAS: | 94470-67-4 |
| Molecular Formula: | C16H18N2O3 |
| Molecular Weight: | 286.33 |
| InChI: | InChI=1/C16H18N2O3/c1-16(2)15(20)14(18-7-3-4-13(18)19)11-8-10(9-17)5-6-12(11)21-16/h5-6,8,14-15,20H,3-4,7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 245.5°C |
| Boiling Point: | 482.3°C at 760 mmHg |
| Density: | 1.31g/cm3 |
| Refractive index: | 1.615 |
| Specification: | White Crystalline Solid usageEng:Causes vasodilation by activation of potassim channels Safety Statements:22-24/25 22:Do not breathe dust 24/25:Avoid contact with skin and eyes |
| Biological Activity: | Prototypical K ATP channel opener. Relaxes rabbit isolated portal vein with an IC 50 value of 21 nM . Potent, orally active and hypotensive in vivo . |
| Flash Point: | 245.5°C |
| Storage Temperature: | 2-8°C |
| Usage: | Causes vasodilation by activation of potassim channels |
| Safety Data | |
 |
|
