| Identification | |
| Name: | 6-Bromo-2,3-dihydrobenzofuran-3-amine |
| Synonyms: | 6-Bromo-2,3-dihydro-3-benzofuranamine |
| CAS: | 944709-63-1 |
| Molecular Formula: | C8H8BrNO |
| Molecular Weight: | 214.06 |
| InChI: | InChI=1/C8H8BrNO.ClH/c9-5-1-2-6-7(10)4-11-8(6)3-5;/h1-3,7H,4,10H2;1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.605 |
| Specification: |
The 6-Bromo-2,3-dihydrobenzofuran-3-amine, with the CAS registry number 944709-63-1, has the systematic name of 6-bromo-2,3-dihydrobenzofuran-3-amine hydrochloride. The molecular formula of the chemical is C8H8BrNO.HCl. The characteristics of this chemical are as followings: (1)ACD/LogP: 1.61; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 7.4): 0.93 ; (4)#H bond acceptors: 2; (5)#H bond donors: 2; (6)#Freely Rotating Bonds: 1; (7)Polar Surface Area: 35.25 Å2; (8)Flash Point: 134.5 °C; (9)Enthalpy of Vaporization: 54.95 kJ/mol; (10)Boiling Point: 298.8 °C at 760 mmHg; (11)Vapour Pressure: 0.00093 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
