| Identification | |
| Name: | Pyrido[4,3-d]pyrimidine,4-chloro-5,6,7,8-tetrahydro-2-(methylthio)- |
| Synonyms: | 4-chloro-2-methylsulfanyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine;4-Chloro-5,6,7,8-tetrahydro-2-(methylthio)pyrido[4,3-d]pyrimidine;pyrido[4,3-d]pyrimidine, 4-chloro-5,6,7,8-tetrahydro-2-(methylthio)-; |
| CAS: | 944902-03-8 |
| Molecular Formula: | C8H10ClN3S |
| Molecular Weight: | 215.70 |
| InChI: | InChI=1/C8H10ClN3S/c1-13-8-11-6-2-3-10-4-5(6)7(9)12-8/h10H,2-4H2,1H3 |
| Molecular Structure: | ![(C8H10ClN3S) 4-chloro-2-methylsulfanyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine;4-Chloro-5,6,7,8-tetrahydro-2-(m...](https://img1.guidechem.com/chem/e/dict/168/944902-03-8.jpg) |
| Properties | |
| Density: | 1.39 g/cm3 |
| Refractive index: | 1.633 |
| Specification: |
The 4-Chloro-5,6,7,8-tetrahydro-2-(methylthio)pyrido[4,3-d]pyrimidine, with the cas registry number 944902-03-8, has the systematic name of 4-chloro-2-methylsulfanyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine. It belongs to the category of chiral chemicals. And the molecular formula of the chemical is C8H10ClN3S. The characteristics of this chemical are as followings: (1)ACD/LogP: 0.79; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.23; (4)ACD/LogD (pH 7.4): 0.78; (5)#H bond acceptors: 3; (6)#H bond donors: 1; (7)#Freely Rotating Bonds: 1; (8)Polar Surface Area: 63.11 Å2; (9)Index of Refraction: 1.633; (10)Molar Refractivity: 55.3 cm3; (11)Molar Volume: 154.8 cm3; (12)Polarizability: 21.92×10-24cm3; (13)Surface Tension: 65 dyne/cm; (14)Density: 1.39 g/cm3; (15)Flash Point: 179.3 °C; (16)Enthalpy of Vaporization: 62 kJ/mol; (17)Boiling Point: 372.8 °C at 760 mmHg; (18)Vapour Pressure: 9.37E-06 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
