| Identification |
| Name: | 2,3,4,5-Tetrafluorobenzoyl chloride |
| Synonyms: | 2,3,4,5-Tetrafluorboenzoyl Chloride; 2,3,4,5-Tetrafluorobezoyl chloride |
| CAS: | 94695-48-4 |
| EINECS: | -0 |
| Molecular Formula: | C7HClF4O |
| Molecular Weight: | 212.53 |
| InChI: | InChI=1/C7HClF4O/c8-7(13)2-1-3(9)5(11)6(12)4(2)10/h1H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Boiling Point: | 174.4°Cat760mmHg |
| Density: | 1.58 |
| Stability: | Stable under normal shipping and handling conditions. |
| Refractive index: | 1.478-1.49 |
| Solubility: | Insoluble |
| Appearance: | Colorless liquid with a characteristic odor. |
| Packinggroup: | II |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. Corrosives area. |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
