Identification |
Name: | 2,3,4,5-Tetrafluorobenzoyl chloride |
Synonyms: | 2,3,4,5-Tetrafluorboenzoyl Chloride; 2,3,4,5-Tetrafluorobezoyl chloride |
CAS: | 94695-48-4 |
EINECS: | -0 |
Molecular Formula: | C7HClF4O |
Molecular Weight: | 212.53 |
InChI: | InChI=1/C7HClF4O/c8-7(13)2-1-3(9)5(11)6(12)4(2)10/h1H |
Molecular Structure: |
 |
Properties |
Transport: | UN 3265 |
Boiling Point: | 174.4°Cat760mmHg |
Density: | 1.58 |
Stability: | Stable under normal shipping and handling conditions. |
Refractive index: | 1.478-1.49 |
Solubility: | Insoluble |
Appearance: | Colorless liquid with a characteristic odor. |
Packinggroup: | II |
Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. Corrosives area. |
Sensitive: | Moisture Sensitive |
Safety Data |
Hazard Symbols |
C:Corrosive
|
|
 |