| Identification | |
| Name: | (+-)-Imazapyr |
| Synonyms: | Brn 5442754;Caswell no. 003f |
| CAS: | 94795-74-1 |
| Molecular Formula: | C13H15N3O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C13H15N3O3/c1-7(2)13(3)12(19)15-10(16-13)9-8(11(17)18)5-4-6-14-9/h4-7H,1-3H3,(H,17,18)(H,15,16,19) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 171 deg C |
| Solubility: | In acetone 3.39, dimethyl sulfoxide 47.1, hexane 0.00095, methanol 10.5, methylene chloride 8.72, toluene 0.180 (25 deg C, all in g/100 ml. In water, 1.13X10+4 mg/l @ 25 deg C |
| Color: | Clear, slightly viscous, pale yellow to dark green aqueous liquid White to tan powder Crystals from acetone + hexane |
| Safety Data | |
 |
|
