| Identification | |
| Name: | 2-Phenylindole |
| Synonyms: | 2-PHENYL INDOLE |
| CAS: | 948-65-2 |
| EINECS: | 213-436-3 |
| Molecular Formula: | C14H11N |
| Molecular Weight: | 193.25 |
| InChI: | InChI=1/C14H11N/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14/h1-10,15H |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | 176.6 ºC |
| Density: | 1.156 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | SOLVENT |
| Solubility: | SOLVENT |
| Appearance: | off-white to yellowish powder |
| Flash Point: | 176.6 ºC |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Stabilizer. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
