| Identification | |
| Name: | 4-Piperidinone,1-(phenylmethyl)-, oxime |
| Synonyms: | 4-Piperidone,1-benzyl-, oxime (6CI,7CI,8CI);1-Benzyl-4-piperidinone oxime;1-Benzyl-4-piperidone oxime; |
| CAS: | 949-69-9 |
| EINECS: | 213-443-1 |
| Molecular Formula: | C12H16N2O |
| Molecular Weight: | 204.27 |
| InChI: | InChI=1/C12H16N2O/c15-13-12-6-8-14(9-7-12)10-11-4-2-1-3-5-11/h1-5,15H,6-10H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 158.5°C |
| Boiling Point: | 338.5°Cat760mmHg |
| Density: | 1.12g/cm3 |
| Refractive index: | 1.582 |
| Specification: |
The 1-Benzylpiperidin-4-one oxime with the CAS number 949-69-9 is also called 4-Piperidinone,1-(phenylmethyl)-, oxime. The IUPAC name is N-(1-benzylpiperidin-4-ylidene)hydroxylamine. Its EINECS registry number is 213-443-1. The molecular formula is C12H16N2O. The product category is Piperidine. The properties of the chemical are: (1)ACD/LogP: 1.55; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.06; (4)ACD/LogD (pH 7.4): 1.41; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 6.38; (7)ACD/KOC (pH 5.5): 5.35; (8)ACD/KOC (pH 7.4): 119.54; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 24.83 Å2; (13)Index of Refraction: 1.582; (14)Molar Refractivity: 60.61 cm3; (15)Molar Volume: 181.5 cm3; (16)Polarizability: 24.02×10-24cm3; (17)Surface Tension: 44 dyne/cm ; (18)Enthalpy of Vaporization: 61.41 kJ/mol; (19)Vapour Pressure: 3.82×10-5 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 158.5°C |
| Safety Data | |
 |
|
