| Identification | |
| Name: | 2,4-Dihydroxybenzaldehyde |
| Synonyms: | beta-Resorcylaldehyde |
| CAS: | 95-01-2 |
| EINECS: | 202-383-1 |
| Molecular Formula: | C7H6O3 |
| Molecular Weight: | 138.12 |
| InChI: | InChI=1/C7H6O3/c8-4-5-1-2-6(9)3-7(5)10/h1-4,9-10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.409 g/cm3 |
| Stability: | Stable. May be air sensitive. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.674 |
| Water Solubility: | soluble |
| Solubility: | freely soluble AUTOIGNITION |
| Appearance: | white needle crystal |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I; II; III |
| HS Code: | 29124900 |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
