| Identification | |
| Name: | 5-Pyrimidinemethanamine,4-amino-2-methyl- |
| Synonyms: | Pyrimidine,4-amino-5-(aminomethyl)-2-methyl- (6CI,8CI);2-Methyl-4-amino-5-(aminomethyl)pyrimidine; 4-Amino-5-aminomethyl-2-methylpyrimidine;5-(Aminomethyl)-4-amino-2-methylpyrimidine; Grewe diamine |
| CAS: | 95-02-3 |
| EINECS: | 202-384-7 |
| Molecular Formula: | C6H10 N4 |
| Molecular Weight: | 211.09 |
| InChI: | InChI=1/C6H10N4/c1-4-9-3-5(2-7)6(8)10-4/h3H,2,7H2,1H3,(H2,8,9,10) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.207g/cm3 |
| Specification: | Off-White Solid usageEng:Substrate for TenA enzyme in the thiamin salvage pathway |
| Usage: | Substrate for TenA enzyme in the thiamin salvage pathway |
| Safety Data | |
 |
|
