| Identification | |
| Name: | Bicyclo[2.2.1]hept-5-ene-2-methanamine |
| Synonyms: | 5-Norbornene-2-methylamine(6CI,7CI,8CI); 1-Bicyclo[2.2.1]hept-5-en-2-ylmethanamine;5-(Aminomethyl)bicyclo[2.2.1]hept-2-ene; 5-(Aminomethyl)norbornene; NSC 61481;NSC 61523 |
| CAS: | 95-10-3 |
| Molecular Formula: | C8H13 N |
| Molecular Weight: | 123.2 |
| InChI: | InChI=1/C8H13N/c9-5-8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-5,9H2 |
| Molecular Structure: | ![(C8H13N) 5-Norbornene-2-methylamine(6CI,7CI,8CI); 1-Bicyclo[2.2.1]hept-5-en-2-ylmethanamine;5-(Aminomethyl)bi...](https://img1.guidechem.com/chem/e/dict/43/95-10-3.jpg) |
| Properties | |
| Flash Point: | 71.5°C |
| Boiling Point: | 186.1°Cat760mmHg |
| Density: | 0.999g/cm3 |
| Refractive index: | 1.531 |
| Specification: |
The 5-Norbornene-2-methylamine with cas registry number of 95-10-3, belongs to the following product categorie: Norbornene Derivatives. Its IUPAC name is 5-bicyclo[2.2.1]hept-2-enylmethanamine. Its hazard class is irritant. Physical properties about this chemical are: (1)XLogP3-AA: 1; (2)H-Bond Donor: 1; (3)H-Bond Acceptor: 1; (4)Rotatable Bond Count: 1; (5)Exact Mass: 123.104799; (6)MonoIsotopic Mass: 123.104799; (7)Topological Polar Surface Area: 26; (8)Heavy Atom Count: 9; (9)Formal Charge: 0; (10)Complexity: 140; (11)Isotope Atom Count: 0; (12)Defined Atom StereoCenter Count: 0; (13)Undefined Atom StereoCenter Count: 3; (14)Defined Bond StereoCenter Count: 0; (15)Undefined Bond StereoCenter Count: 0; (16)Covalently-Bonded Unit Count: 1. Uses of 5-Norbornene-2-methylamine: it can be used to produce N-(5-norbornen-2-ylmethyl) camphorimine with Pernitrosocampher. The reaction will need reagent toluene. The yield is about 95%. |
| Flash Point: | 71.5°C |
| Safety Data | |
 |
|
