| Identification | |
| Name: | Indene |
| Synonyms: | Indene, 99%; Indenepract |
| CAS: | 95-13-6 |
| EINECS: | 202-393-6 |
| Molecular Formula: | C9H8 |
| Molecular Weight: | 116.16 |
| InChI: | InChI=1/C9H8/c1-2-5-9-7-3-6-8(9)4-1/h1-6H,7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3295 |
| Density: | 0.996 |
| Stability: | Stable, but air and light sensitive; may polymerize upon exposure to light. Typically contains aroung 80 - 100 ppm of p-tert-butylcatechol as inhibitor. Refrigerate. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.567-1.572 |
| Water Solubility: | INSOLUBLE |
| Solubility: | INSOLUBLE |
| Appearance: | pale yellow to orange liquid |
| Specification: |
Indene , its CAS NO. is 95-13-6, the synonyms are 1H-Indene ; HSDB 5286 ; Inden ; Indonaphthene ; NSC 9270 . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
