| Identification | |
| Name: | Thianaphthene |
| Synonyms: | 1-Benzothiophene;1-Thiaindene;2,3-Benzothiophene;Benzothiofuran;Benzothiophen;Benzothiophene;NSC 47196;Thianaphthen; |
| CAS: | 95-15-8 |
| EINECS: | 202-395-7 |
| Molecular Formula: | C8H6S |
| Molecular Weight: | 134.19 |
| InChI: | InChI=1/C8H6S/c1-2-4-8-7(3-1)5-6-9-8/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 |
| Density: | 1.149 |
| Stability: | No data. |
| Refractive index: | 1.6374 (37 C) |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | white to red crystalline low melting solid |
| Specification: |
?Thianaphthene (CAS NO.95-15-8) is also named as 1-Benzothiophene ; 1-Thiaindene ; 2,3-Benzothiophene ; AI3-15523 ; Benzothiofuran ; Benzothiophen ;?NSC 47196 ; Thianaphtene ; Thianaphthen?.?Thianaphthene (CAS NO.95-15-8) is white to red crystalline low melting solid. |
| Packinggroup: | III |
| HS Code: | 29349990 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Production of pharmaceuticals, thioindigo. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
