| Identification | |
| Name: | Chlorzoxazone |
| Synonyms: | 2-Benzothiazolinone; 5-chloro-2-benzoxazolone |
| CAS: | 95-25-0 |
| EINECS: | 202-403-9 |
| Molecular Formula: | C7H4ClNO2 |
| Molecular Weight: | 169.57 |
| InChI: | InChI=1/C7H4ClNO2/c8-4-1-2-6-5(3-4)9-7(10)11-6/h1-3H,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Density: | 1.486 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | 0.1 g/100 mL |
| Appearance: | white to off-white crystalline powder |
| Specification: | White to Off-White Solid usageEng:Muscle relaxant (skeletal) Safety Statements:26-36-24/25-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Muscle relaxant (skeletal) |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
