| Identification | |
| Name: | Benzenamine,2-chloro- |
| Synonyms: | Aniline,o-chloro- (8CI);1-Amino-2-chlorobenzene;2-Amino-1-chlorobenzene;2-Chloroaniline;2-Chlorobenzenamine;2-Chlorophenylamine;Fast Yellow GC Base;NSC 6183;o-Aminochlorobenzene;o-Chloroaniline; |
| CAS: | 95-51-2 |
| EINECS: | 202-426-4 |
| Molecular Formula: | C6H6 Cl N |
| Molecular Weight: | 127.57 |
| InChI: | InChI=1/C6H6ClN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2019 |
| Density: | 1.213 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.587-1.589 |
| Solubility: | insoluble SOLVENT |
| Appearance: | Clear amber liquid |
| Packinggroup: | II |
| HS Code: | 29214210 |
| Color: | Amber liquid Water-white to tan liquid Colorless liquid |
| Usage: | Dye, pesticide, pigment, rubber chemicals intermediate. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
