| Identification | |
| Name: | o-Toluidine |
| Synonyms: | 2-Aminotoluene; 2-Methylaniline; 2-Toluidine; 2-methylbenzenamine; 1-Amino-2-methylbenzene; 1-Methyl-2-aminobenzene; Ortho Toluidine; OT |
| CAS: | 95-53-4 |
| EINECS: | 202-429-0 |
| Molecular Formula: | C7H9N |
| Molecular Weight: | 107.15 |
| InChI: | InChI=1/C7H9N/c1-6-4-2-3-5-7(6)8/h2-5H,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1708 |
| Density: | 1.008 |
| Stability: | Stable under normal temperatures and pressures. Substance undergoes color change upon exposure to light and air. |
| Refractive index: | 1.571-1.573 |
| Solubility: | 1.5 g/100 mL (25 oC) |
| Appearance: | light yellow to light amber liquid |
| Packinggroup: | II |
| HS Code: | 29214300 |
| Color: | light yellow to light amber |
| Usage: | A carcinogenic and toxic aromatic amine contained in hair dye, henna and dyed hair samples. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
 |
|
