| Identification |
| Name: | 1,2,4-Trimethylbenzene |
| Synonyms: | Pseudocumene; Trimethylbenzene; 98%; 1,2,4-Trimethylbenzene = Pseudocumene; 1,2,4-Trimethylbenzere |
| CAS: | 95-63-6 |
| EINECS: | 202-436-9 |
| Molecular Formula: | C9H12 |
| Molecular Weight: | 120.19 |
| InChI: | InChI=1/C9H12/c1-7-4-5-8(2)9(3)6-7/h4-6H,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 170kgs |
| Density: | 0.88 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Flammable. May form explosive mixtures with air. |
| Refractive index: | n20/D 1.504(lit.) |
| Water Solubility: | Insoluble
(miscible with alcohol, benzene, ether) |
| Solubility: | Insoluble
(miscible with alcohol, benzene, ether) |
| Appearance: | clear liquid |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Color: | Clear, colorless liquid |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
| |
 |
