Identification |
Name: | 1,2,4-Trimethylbenzene |
Synonyms: | Pseudocumene; Trimethylbenzene; 98%; 1,2,4-Trimethylbenzene = Pseudocumene; 1,2,4-Trimethylbenzere |
CAS: | 95-63-6 |
EINECS: | 202-436-9 |
Molecular Formula: | C9H12 |
Molecular Weight: | 120.19 |
InChI: | InChI=1/C9H12/c1-7-4-5-8(2)9(3)6-7/h4-6H,1-3H3 |
Molecular Structure: |
 |
Properties |
Transport: | 170kgs |
Density: | 0.88 |
Stability: | Stable. Incompatible with strong oxidizing agents. Flammable. May form explosive mixtures with air. |
Refractive index: | n20/D 1.504(lit.) |
Water Solubility: | Insoluble
(miscible with alcohol, benzene, ether) |
Solubility: | Insoluble
(miscible with alcohol, benzene, ether) |
Appearance: | clear liquid |
Packinggroup: | III |
Storage Temperature: | 2-8°C |
Color: | Clear, colorless liquid |
Safety Data |
Hazard Symbols |
Xn:Harmful
N:Dangerousfortheenvironment
|
|
 |