| Identification | ||
| Name: | 2,5-Dimethylaniline | |
| Synonyms: | 2,5-Xylidine | |
| CAS: | 95-78-3 | |
| EINECS: | 202-451-0 | |
| Molecular Formula: | C8H11N | |
| Molecular Weight: | 121.18 | |
| InChI: | InChI=1/C8H11N/c1-6-3-4-7(2)8(9)5-6/h3-5H,9H2,1-2H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 1711 | |
| Density: | 0.973 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Refractive index: | 1.5582-1.5602 | |
| Water Solubility: | <0.1 g/100 mL at 18 ºC | |
| Solubility: | <0.1 g/100 mL at 18 ºC in water | |
| Appearance: | Yellow liquid turns to darken when exposed to light and air | |
| Specification: |
2,5-Xylidine (CAS NO.95-78-3), its Synonyms are Benzenamine, 2,5-dimethyl- ; 1-Amino-2,5-dimethylbenzene ; 2,5-Dimethylaniline ; 2,5-Dimethylbenzenamine ; 2,5-Dimethylphenylamine ; 2-Amino-1,4-xylene ; 3-Amino-1,4-dimethylbenzene ; 5-Amino-1,4-dimethylbenzene ; 5-Methyl-o-toluidine ; 6-Methyl-m-toluidine . It is clear yellow to red-brown liquid. | |
| Packinggroup: | II | |
| HS Code: | 29214910 | |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. | |
| Color: | YELLOW LEAF FROM PETROLEUM ETHER Colorless to yellow oil Yellow liquid or solid | |
| Usage: | Chemical intermediate for solvent red 26, direct violet 7. | |
| Safety Data | ||
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
|
 |
||
