| Identification | |
| Name: | 2,5-Dichloroaniline |
| Synonyms: | fast scarlet GG base; C.I. 37010; 2,5-Dichloro aniline |
| CAS: | 95-82-9 |
| EINECS: | 202-455-2 |
| Molecular Formula: | C6H5Cl2N |
| Molecular Weight: | 162.02 |
| InChI: | InChI=1/C6H5Cl2N/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3442 |
| Density: | 1.401 g/cm3 |
| Stability: | Stable. Incompatible with acids, acid chlorides, acid anhydrides, oxidizing agents. |
| Refractive index: | 1.613 |
| Solubility: | ca. 0.56 g/L (20 oC) |
| Appearance: | light brown solid |
| Packinggroup: | II |
| HS Code: | 29214210 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool place in the original container and protect from sunlight. Store in a tightly closed container. Store in a dry area. |
| Usage: | Dye intermediate. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
 |
|
